ChemNet > CAS > 2103-88-0 2-Mercapto-4-phenylthiazole
2103-88-0 2-Mercapto-4-phenylthiazole
| 상품명칭 |
2-Mercapto-4-phenylthiazole |
| 영문 이름 |
2-Mercapto-4-phenylthiazole; 4-Phenyl-2-thiazolethiol; 4-phenyl-1,3-thiazole-2(3H)-thione |
| 분자식 |
C9H7NS2 |
| 분자량 |
193.2886 |
| InChI |
InChI=1/C9H7NS2/c11-9-10-8(6-12-9)7-4-2-1-3-5-7/h1-6H,(H,10,11) |
| cas번호 |
2103-88-0 |
| EC번호 |
218-274-7 |
| 분자 구조 |
|
| 밀도 |
1.37g/cm3 |
| 비등점 |
333.1°C at 760 mmHg |
| 굴절 지수 |
1.744 |
| 인화점 |
155.2°C |
| 증기압 |
0.00014mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
