ChemNet > CAS > 2103-91-5 2-Amino-4-(p-tolyl)thiazole
2103-91-5 2-Amino-4-(p-tolyl)thiazole
| 상품명칭 |
2-Amino-4-(p-tolyl)thiazole |
| 영문 이름 |
2-Amino-4-(p-tolyl)thiazole; 4-(4-Methylphenyl)-2-thiazolamine; 4-(4-methylphenyl)-1,3-thiazol-2-amine |
| 분자식 |
C10H10N2S |
| 분자량 |
190.2648 |
| InChI |
InChI=1/C10H10N2S/c1-7-2-4-8(5-3-7)9-6-13-10(11)12-9/h2-6H,1H3,(H2,11,12) |
| cas번호 |
2103-91-5 |
| 분자 구조 |
|
| 밀도 |
1.219g/cm3 |
| 녹는 점 |
132-136℃ |
| 비등점 |
369.4°C at 760 mmHg |
| 굴절 지수 |
1.642 |
| 인화점 |
177.2°C |
| 증기압 |
1.19E-05mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
