ChemNet > CAS > 2107-77-9 7,8-Dihydroxy-4-methylcoumarin
2107-77-9 7,8-Dihydroxy-4-methylcoumarin
| 상품명칭 |
7,8-Dihydroxy-4-methylcoumarin |
| 영문 이름 |
7,8-Dihydroxy-4-methylcoumarin; 4-Methyldaphnetin; 7,8-dihydroxy-4-methyl-2H-chromen-2-one |
| 분자식 |
C10H8O4 |
| 분자량 |
192.1681 |
| InChI |
InChI=1/C10H8O4/c1-5-4-8(12)14-10-6(5)2-3-7(11)9(10)13/h2-4,11,13H,1H3 |
| cas번호 |
2107-77-9 |
| EC번호 |
218-290-4 |
| 분자 구조 |
|
| 밀도 |
1.456g/cm3 |
| 비등점 |
421.5°C at 760 mmHg |
| 굴절 지수 |
1.651 |
| 인화점 |
176°C |
| 증기압 |
1.05E-07mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
