ChemNet > CAS > 2113-58-8 3-Nitrobiphenyl
2113-58-8 3-Nitrobiphenyl
| 상품명칭 |
3-Nitrobiphenyl |
| 영문 이름 |
3-Nitrobiphenyl; 3-Nitrodiphenyl |
| 분자식 |
C12H9NO2 |
| 분자량 |
199.2054 |
| InChI |
InChI=1/C12H9NO2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
| cas번호 |
2113-58-8 |
| EC번호 |
218-305-4 |
| 분자 구조 |
|
| 밀도 |
1.196g/cm3 |
| 녹는 점 |
56-60℃ |
| 비등점 |
339°C at 760 mmHg |
| 굴절 지수 |
1.605 |
| 인화점 |
161.4°C |
| 증기압 |
0.000186mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R40:Possible risks of irreversible effects.;
|
| 보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
