ChemNet > CAS > 2117-36-4 Tri-n-butylgermanium chloride
2117-36-4 Tri-n-butylgermanium chloride
| 상품명칭 |
Tri-n-butylgermanium chloride |
| 영문 이름 |
Tri-n-butylgermanium chloride; Tributylgermanium chloride; Tri-n-butylchlorogermane; tributyl(chloro)germane; tributylgermanylium chloride |
| 분자식 |
C12H27ClGe |
| 분자량 |
279.4358 |
| InChI |
InChI=1/C12H27Ge.ClH/c1-4-7-10-13(11-8-5-2)12-9-6-3;/h4-12H2,1-3H3;1H/q+1;/p-1 |
| cas번호 |
2117-36-4 |
| EC번호 |
218-323-2 |
| 분자 구조 |
|
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R22:Harmful if swallowed.;
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
