ChemNet > CAS > 212779-19-6 2,3,5-Trichlorobenzeneboronic acid
212779-19-6 2,3,5-Trichlorobenzeneboronic acid
상품명칭 |
2,3,5-Trichlorobenzeneboronic acid |
영문 이름 |
2,3,5-Trichlorobenzeneboronic acid; Thiocarbamoylhydrazine; (2,3,5-trichlorophenyl)boronic acid; Boronic acid,B-(2,3,5-trichlorophenyl)-; 2,3,5-Trichlorophenylboronic acid |
분자식 |
C6H4BCl3O2 |
분자량 |
225.2648 |
InChI |
InChI=1/C6H4BCl3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,11-12H |
cas번호 |
212779-19-6 |
분자 구조 |
|
밀도 |
1.6g/cm3 |
비등점 |
383.4°C at 760 mmHg |
굴절 지수 |
1.594 |
인화점 |
185.7°C |
증기압 |
1.46E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|