ChemNet > CAS > 2131-55-7 4-Chlorophenyl isothiocyanate
2131-55-7 4-Chlorophenyl isothiocyanate
| 상품명칭 |
4-Chlorophenyl isothiocyanate |
| 영문 이름 |
4-Chlorophenyl isothiocyanate; Isothiocyanic Acid 4-Chlorophenyl Ester; 1-chloro-4-isothiocyanatobenzene; 4-Chloro-phenylisothiocyanate |
| 분자식 |
C7H4ClNS |
| 분자량 |
169.6314 |
| InChI |
InChI=1/C7H4ClNS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| cas번호 |
2131-55-7 |
| EC번호 |
218-358-3 |
| 분자 구조 |
|
| 밀도 |
1.21g/cm3 |
| 녹는 점 |
43-136℃ |
| 비등점 |
250.2°C at 760 mmHg |
| 굴절 지수 |
1.593 |
| 인화점 |
105.1°C |
| 증기압 |
0.0347mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
