ChemNet > CAS > 21327-86-6 2-Chloro-6-Methylbenzoic Acid
21327-86-6 2-Chloro-6-Methylbenzoic Acid
상품명칭 |
2-Chloro-6-Methylbenzoic Acid |
영문 이름 |
2-Chloro-6-Methylbenzoic Acid; 6-Chloro-o-toluic acid (COOH=1); 6-Chloro-o-toluic acid; Benzoic acid,2-chloro-6-methyl-; 2-Choro-6-methyl-benzoic acid |
분자식 |
C8H7ClO2 |
분자량 |
170.593 |
InChI |
InChI=1/C8H7ClO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,1H3,(H,10,11) |
cas번호 |
21327-86-6 |
분자 구조 |
|
밀도 |
1.31g/cm3 |
비등점 |
289.9°C at 760 mmHg |
굴절 지수 |
1.573 |
인화점 |
129.2°C |
증기압 |
0.000984mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|