ChemNet > CAS > 2150-43-8 Methyl 3,4-dihydroxybenzoate
2150-43-8 Methyl 3,4-dihydroxybenzoate
상품명칭 |
Methyl 3,4-dihydroxybenzoate |
영문 이름 |
Methyl 3,4-dihydroxybenzoate; 3,4-Dihydroxybenzoic acid methyl ester; Methyl protocatechuate |
분자식 |
C8H8O4 |
분자량 |
168.1467 |
InChI |
InChI=1/C8H8O4/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,9-10H,1H3 |
cas번호 |
2150-43-8 |
분자 구조 |
|
밀도 |
1.354g/cm3 |
비등점 |
351.5°C at 760 mmHg |
굴절 지수 |
1.587 |
인화점 |
148.5°C |
증기압 |
2.02E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|