2155-60-4 dibutyl itaconate
상품명칭 |
dibutyl itaconate |
영문 이름 |
dibutyl itaconate; Itaconic acid di-n-butyl ester; dibutyl 2-methylidenebutanedioate |
분자식 |
C13H22O4 |
분자량 |
242.3114 |
InChI |
InChI=1/C13H22O4/c1-4-6-8-16-12(14)10-11(3)13(15)17-9-7-5-2/h3-10H2,1-2H3 |
cas번호 |
2155-60-4 |
EC번호 |
218-451-9 |
분자 구조 |
|
밀도 |
0.989g/cm3 |
비등점 |
307.4°C at 760 mmHg |
굴절 지수 |
1.446 |
인화점 |
142.2°C |
증기압 |
0.000728mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|