ChemNet > CAS > 2156-04-9 4-Vinylbenzeneboronic acid
2156-04-9 4-Vinylbenzeneboronic acid
상품명칭 |
4-Vinylbenzeneboronic acid |
영문 이름 |
4-Vinylbenzeneboronic acid; 4-Vinylphenylboronic acid; Styrene-4-boronic acid; (4-ethenylphenyl)boronic acid |
분자식 |
C8H9BO2 |
분자량 |
147.9669 |
InChI |
InChI=1/C8H9BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h2-6,10-11H,1H2 |
cas번호 |
2156-04-9 |
분자 구조 |
|
밀도 |
1.09g/cm3 |
녹는 점 |
188-189℃ |
비등점 |
306.2°C at 760 mmHg |
굴절 지수 |
1.539 |
인화점 |
139°C |
증기압 |
0.000341mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|