ChemNet > CAS > 21622-18-4 2,3,4,5-Tetrafluorobenzylchloride
21622-18-4 2,3,4,5-Tetrafluorobenzylchloride
| 상품명칭 |
2,3,4,5-Tetrafluorobenzylchloride |
| 영문 이름 |
2,3,4,5-Tetrafluorobenzylchloride; 2,3,4,6-Tetrafluorobenzyl chloride; 2-(chloromethyl)-1,3,4,5-tetrafluorobenzene |
| 분자식 |
C7H3ClF4 |
| 분자량 |
198.5453 |
| InChI |
InChI=1/C7H3ClF4/c8-2-3-4(9)1-5(10)7(12)6(3)11/h1H,2H2 |
| cas번호 |
21622-18-4 |
| 분자 구조 |
|
| 밀도 |
1.482g/cm3 |
| 비등점 |
164.1°C at 760 mmHg |
| 굴절 지수 |
1.449 |
| 인화점 |
57.5°C |
| 증기압 |
2.62mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R34:Causes burns.;
R37:Irritating to respiratory system.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
