ChemNet > CAS > 216393-64-5 4-Bromo-2-fluorobenzeneboronic acid
216393-64-5 4-Bromo-2-fluorobenzeneboronic acid
| 상품명칭 |
4-Bromo-2-fluorobenzeneboronic acid |
| 영문 이름 |
4-Bromo-2-fluorobenzeneboronic acid; 4-Bromo-2-fluorophenylboronic acid |
| 분자식 |
C6H5BBrFO2 |
| 분자량 |
218.8161 |
| InChI |
InChI=1/C6H5BBrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
| cas번호 |
216393-64-5 |
| 분자 구조 |
|
| 밀도 |
1.75g/cm3 |
| 비등점 |
310.6°C at 760 mmHg |
| 굴절 지수 |
1.571 |
| 인화점 |
141.6°C |
| 증기압 |
0.000255mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
