2177-70-0 Phenyl Methacrylate
상품명칭 |
Phenyl Methacrylate |
영문 이름 |
Phenyl Methacrylate; Phenyl
methacrylate, (Methacrylic acid phenyl ester); Methacrylic acid phenyl ester; phenyl 2-methylprop-2-enoate |
분자식 |
C10H10O2 |
분자량 |
162.1852 |
InChI |
InChI=1/C10H10O2/c1-8(2)10(11)12-9-6-4-3-5-7-9/h3-7H,1H2,2H3 |
cas번호 |
2177-70-0 |
EC번호 |
218-542-3 |
분자 구조 |
|
밀도 |
1.046g/cm3 |
비등점 |
249.3°C at 760 mmHg |
굴절 지수 |
1.511 |
인화점 |
97.1°C |
증기압 |
0.0231mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|