21854-95-5 2,2'-Dichlorobenzil
상품명칭 |
2,2'-Dichlorobenzil |
영문 이름 |
2,2'-Dichlorobenzil; 2,2-Dichlorodibenzoyl; 1,2-bis(2-chlorophenyl)ethane-1,2-dione |
분자식 |
C14H8Cl2O2 |
분자량 |
279.1181 |
InChI |
InChI=1/C14H8Cl2O2/c15-11-7-3-1-5-9(11)13(17)14(18)10-6-2-4-8-12(10)16/h1-8H |
cas번호 |
21854-95-5 |
분자 구조 |
|
밀도 |
1.366g/cm3 |
비등점 |
426.9°C at 760 mmHg |
굴절 지수 |
1.612 |
인화점 |
180.2°C |
증기압 |
1.71E-07mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|