ChemNet > CAS > 220141-71-9 3,5-Difluorobenzylchloride
220141-71-9 3,5-Difluorobenzylchloride
상품명칭 |
3,5-Difluorobenzylchloride |
영문 이름 |
3,5-Difluorobenzylchloride; 3,5-Difluorobenzyl chloride; 1-(chloromethyl)-3,5-difluorobenzene |
분자식 |
C7H5ClF2 |
분자량 |
162.5644 |
InChI |
InChI=1/C7H5ClF2/c8-4-5-1-6(9)3-7(10)2-5/h1-3H,4H2 |
cas번호 |
220141-71-9 |
분자 구조 |
|
밀도 |
1.294g/cm3 |
비등점 |
164.5°C at 760 mmHg |
굴절 지수 |
1.485 |
인화점 |
56.2°C |
증기압 |
2.57mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|