ChemNet > CAS > 220141-73-1 3,4,5-trifluoroacetophenone
220141-73-1 3,4,5-trifluoroacetophenone
| 상품명칭 |
3,4,5-trifluoroacetophenone |
| 영문 이름 |
3,4,5-trifluoroacetophenone; 3',4',5'-Trifluoroacetophenone; 1-(3,4,5-trifluorophenyl)ethanone |
| 분자식 |
C8H5F3O |
| 분자량 |
174.1199 |
| InChI |
InChI=1/C8H5F3O/c1-4(12)5-2-6(9)8(11)7(10)3-5/h2-3H,1H3 |
| cas번호 |
220141-73-1 |
| 분자 구조 |
|
| 밀도 |
1.303g/cm3 |
| 비등점 |
208.8°C at 760 mmHg |
| 굴절 지수 |
1.455 |
| 인화점 |
72.5°C |
| 증기압 |
0.209mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
