ChemNet > CAS > 2206-27-1 (Methyl sulfoxide)-d6
2206-27-1 (Methyl sulfoxide)-d6
| 상품명칭 |
(Methyl sulfoxide)-d6 |
| 영문 이름 |
(Methyl sulfoxide)-d6; Dimethyl-d6 sulfoxide; (Methyl sulfoxide)-d6 with 0.03% TMS packaged in 0.75 ml ampules; dimethyl sulfoxide 99.9 atom % D; Dimethylsulfoxide-d6; Dimethyl-d6 sulphoxide + 0.05% TMS (v/v); Dimethylsulfoxidedisotopicpurity; Dimethyl sulfoxide-d6; (methylsulfinyl)methane; [(~2~H_3_)methylsulfinyl](~2~H_3_)methane |
| 분자식 |
C2D6OS |
| 분자량 |
84.1704 |
| InChI |
InChI=1/C2H6OS/c1-4(2)3/h1-2H3/i1D3,2D3 |
| cas번호 |
2206-27-1 |
| EC번호 |
218-617-0 |
| 분자 구조 |
|
| 밀도 |
1.184g/cm3 |
| 녹는 점 |
20-56℃ |
| 비등점 |
189°C at 760 mmHg |
| 굴절 지수 |
1.479 |
| 인화점 |
85°C |
| 증기압 |
0.805mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
