2210-28-8 n-Propyl methacrylate
상품명칭 |
n-Propyl methacrylate |
영문 이름 |
n-Propyl methacrylate; n-Propyl methacrylate, (Methacrylic acid n-propyl ester); Methacrylic acid n-propyl ester; propyl 2-methylprop-2-enoate |
분자식 |
C7H12O2 |
분자량 |
128.169 |
InChI |
InChI=1/C7H12O2/c1-4-5-9-7(8)6(2)3/h2,4-5H2,1,3H3 |
cas번호 |
2210-28-8 |
EC번호 |
218-639-0 |
분자 구조 |
|
밀도 |
0.899g/cm3 |
비등점 |
141°C at 760 mmHg |
굴절 지수 |
1.416 |
인화점 |
34.7°C |
증기압 |
5.98mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|