2216-45-7 4-Methylbenzyl acetate
상품명칭 |
4-Methylbenzyl acetate |
영문 이름 |
4-Methylbenzyl acetate; Benzenemethanol, 4-methyl-, 1-acetate; 4-06-00-03173 (Beilstein Handbook Reference); 4-Methylbenzenemethanol acetate; 4-Methylbenzyl ethanoate; AI3-20661; BRN 2046163; NSC 7001; p-Acetoxymethyltoluene; p-Methylbenzyl acetate; p-Methylbenzyl alcohol acetate; p-Tolubenzyl acetate; p-Xylene, alpha-acetoxy; p-Xylyl acetate; Benzenemethanol, 4-methyl-, acetate; Benzyl alcohol, p-methyl-, acetate (6CI,7CI,8CI) |
분자식 |
C10H12O2 |
분자량 |
164.2011 |
InChI |
InChI=1/C10H12O2/c1-8-3-5-10(6-4-8)7-12-9(2)11/h3-6H,7H2,1-2H3 |
cas번호 |
2216-45-7 |
EC번호 |
218-689-3 |
분자 구조 |
|
밀도 |
1.035g/cm3 |
비등점 |
224.5°C at 760 mmHg |
굴절 지수 |
1.505 |
인화점 |
98°C |
증기압 |
0.091mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|