2216-94-6 Ethyl phenylpropiolate
상품명칭 |
Ethyl phenylpropiolate |
영문 이름 |
Ethyl phenylpropiolate; Ethyl phenylacetylenecarboxylate~Phenylpropiolic acid ethyl ester; ethyl 3-phenylprop-2-ynoate |
분자식 |
C11H10O2 |
분자량 |
174.1959 |
InChI |
InChI=1/C11H10O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h3-7H,2H2,1H3 |
cas번호 |
2216-94-6 |
EC번호 |
218-703-8 |
분자 구조 |
|
밀도 |
1.09g/cm3 |
비등점 |
265°C at 760 mmHg |
굴절 지수 |
1.538 |
인화점 |
124.9°C |
증기압 |
0.0094mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|