2217-79-0 Diphenyliodonium iodide
상품명칭 |
Diphenyliodonium iodide |
영문 이름 |
Diphenyliodonium iodide; AI3-17093; Iodonium, diphenyl-, iodide |
분자식 |
C12H10I2 |
분자량 |
408.02 |
InChI |
InChI=1/C12H10I.HI/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-10H;1H/q+1;/p-1 |
cas번호 |
2217-79-0 |
EC번호 |
218-716-9 |
분자 구조 |
|
녹는 점 |
163-165℃ |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|