ChemNet > CAS > 22236-04-0 2-(difluoromethoxy)aniline
22236-04-0 2-(difluoromethoxy)aniline
| 상품명칭 |
2-(difluoromethoxy)aniline |
| 영문 이름 |
2-(difluoromethoxy)aniline; 2-Difluoromethoxyaniline |
| 분자식 |
C7H7F2NO |
| 분자량 |
159.1334 |
| InChI |
InChI=1/C7H7F2NO/c8-7(9)11-6-4-2-1-3-5(6)10/h1-4,7H,10H2 |
| cas번호 |
22236-04-0 |
| 분자 구조 |
|
| 밀도 |
1.253g/cm3 |
| 비등점 |
209.8°C at 760 mmHg |
| 굴절 지수 |
1.501 |
| 인화점 |
80.7°C |
| 증기압 |
0.199mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
