ChemNet > CAS > 22300-56-7 4-Methyl-2-phenyl-1,2,3-triazole-5-carboxylic acid
22300-56-7 4-Methyl-2-phenyl-1,2,3-triazole-5-carboxylic acid
| 상품명칭 |
4-Methyl-2-phenyl-1,2,3-triazole-5-carboxylic acid |
| 영문 이름 |
4-Methyl-2-phenyl-1,2,3-triazole-5-carboxylic acid; 5-Methyl-2-phenyl-2H-1,2,3-triazole-4-carboxylic acid; 5-methyl-2-phenyl-2H-1,2,3-triazole-4-carboxylate |
| 분자식 |
C10H8N3O2 |
| 분자량 |
202.19 |
| InChI |
InChI=1/C10H9N3O2/c1-7-9(10(14)15)12-13(11-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,14,15)/p-1 |
| cas번호 |
22300-56-7 |
| 분자 구조 |
|
| 녹는 점 |
200℃ |
| 비등점 |
432.9°C at 760 mmHg |
| 인화점 |
215.6°C |
| 증기압 |
2.91E-08mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
