ChemNet > CAS > 226396-32-3 2,3,4-Trifluorophenylboronic acid
226396-32-3 2,3,4-Trifluorophenylboronic acid
상품명칭 |
2,3,4-Trifluorophenylboronic acid |
영문 이름 |
2,3,4-Trifluorophenylboronic acid; |
분자식 |
C6H4BF3O2 |
분자량 |
175.901 |
InChI |
InChI=1/C6H4BF3O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,11-12H |
cas번호 |
226396-32-3 |
분자 구조 |
|
밀도 |
1.44g/cm3 |
녹는 점 |
229-235℃ |
비등점 |
260.2°C at 760 mmHg |
굴절 지수 |
1.465 |
인화점 |
111.2°C |
증기압 |
0.00629mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|