ChemNet > CAS > 2270-59-9 5-Bromo-2-methyl-2-pentene
2270-59-9 5-Bromo-2-methyl-2-pentene
상품명칭 |
5-Bromo-2-methyl-2-pentene |
영문 이름 |
5-Bromo-2-methyl-2-pentene; 5-bromo-2-methylpent-2-ene |
분자식 |
C6H11Br |
분자량 |
163.0555 |
InChI |
InChI=1/C6H11Br/c1-6(2)4-3-5-7/h4H,3,5H2,1-2H3 |
cas번호 |
2270-59-9 |
분자 구조 |
|
밀도 |
1.215g/cm3 |
비등점 |
152.6°C at 760 mmHg |
굴절 지수 |
1.47 |
인화점 |
22.8°C |
증기압 |
4.44mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|