ChemNet > CAS > 22900-83-0 ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate
22900-83-0 ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate
상품명칭 |
ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate |
영문 이름 |
ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate; ethyl 2-bromo-4-methylthiazole-5-carboxylate |
분자식 |
C7H8BrNO2S |
분자량 |
250.1129 |
InChI |
InChI=1/C7H8BrNO2S/c1-3-11-6(10)5-4(2)9-7(8)12-5/h3H2,1-2H3 |
cas번호 |
22900-83-0 |
분자 구조 |
|
밀도 |
1.573g/cm3 |
녹는 점 |
68℃ |
비등점 |
287.086°C at 760 mmHg |
굴절 지수 |
1.563 |
인화점 |
127.426°C |
증기압 |
0.003mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|