ChemNet > CAS > 22921-67-1 5-Acetamido-2-bromobenzoic acid hydrate
22921-67-1 5-Acetamido-2-bromobenzoic acid hydrate
상품명칭 |
5-Acetamido-2-bromobenzoic acid hydrate |
영문 이름 |
5-Acetamido-2-bromobenzoic acid hydrate;5-(acetylamino)-2-bromobenzoic acid; 5-(acetylamino)-2-bromobenzoate |
분자식 |
C9H7BrNO3 |
분자량 |
257.0613 |
InChI |
InChI=1/C9H8BrNO3/c1-5(12)11-6-2-3-8(10)7(4-6)9(13)14/h2-4H,1H3,(H,11,12)(H,13,14)/p-1 |
cas번호 |
22921-67-1 |
분자 구조 |
|
녹는 점 |
186℃ |
비등점 |
466°C at 760 mmHg |
인화점 |
235.6°C |
증기압 |
1.75E-09mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|