ChemNet > CAS > 22921-68-2 2-Bromo-5-methoxybenzoic acid
22921-68-2 2-Bromo-5-methoxybenzoic acid
상품명칭 |
2-Bromo-5-methoxybenzoic acid |
영문 이름 |
2-Bromo-5-methoxybenzoic acid; 6-Bromo-m-anisic acid; 2-bromo-5-methoxybenzoate |
분자식 |
C8H6BrO3 |
분자량 |
230.036 |
InChI |
InChI=1/C8H7BrO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11)/p-1 |
cas번호 |
22921-68-2 |
EC번호 |
245-329-2 |
분자 구조 |
|
녹는 점 |
158-159℃ |
비등점 |
337.8°C at 760 mmHg |
인화점 |
158.1°C |
증기압 |
4E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|