ChemNet > CAS > 23023-13-4 1-(3,4-Methylenedioxy)phenyl-2-butanone
23023-13-4 1-(3,4-Methylenedioxy)phenyl-2-butanone
상품명칭 |
1-(3,4-Methylenedioxy)phenyl-2-butanone |
영문 이름 |
1-(3,4-Methylenedioxy)phenyl-2-butanone; 1-(1,3-Benzodioxol-5-yl)-2-butanone~Ethyl piperonyl ketone; 1-(1,3-benzodioxol-5-yl)butan-2-one |
분자식 |
C11H12O3 |
분자량 |
192.2112 |
InChI |
InChI=1/C11H12O3/c1-2-9(12)5-8-3-4-10-11(6-8)14-7-13-10/h3-4,6H,2,5,7H2,1H3 |
cas번호 |
23023-13-4 |
EC번호 |
245-384-2 |
분자 구조 |
|
밀도 |
1.175g/cm3 |
비등점 |
291.2°C at 760 mmHg |
굴절 지수 |
1.539 |
인화점 |
120.7°C |
증기압 |
0.00198mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|