ChemNet > CAS > 2315-86-8 3-Bromo-4-hydroxybenzonitrile
2315-86-8 3-Bromo-4-hydroxybenzonitrile
상품명칭 |
3-Bromo-4-hydroxybenzonitrile |
영문 이름 |
3-Bromo-4-hydroxybenzonitrile; 2-Bromo-4-cyanophenol |
분자식 |
C7H4BrNO |
분자량 |
198.0168 |
InChI |
InChI=1/C7H4BrNO/c8-6-3-5(4-9)1-2-7(6)10/h1-3,10H |
cas번호 |
2315-86-8 |
EC번호 |
219-022-9 |
분자 구조 |
|
밀도 |
1.79g/cm3 |
녹는 점 |
155℃ |
비등점 |
271.1°C at 760 mmHg |
굴절 지수 |
1.656 |
인화점 |
117.8°C |
증기압 |
0.00396mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|