ChemNet > CAS > 2350-89-2 4-Vinylbiphenyl
2350-89-2 4-Vinylbiphenyl
| 상품명칭 |
4-Vinylbiphenyl |
| 영문 이름 |
4-Vinylbiphenyl; 4-Phenylstyrene; 4-ethenylbiphenyl |
| 분자식 |
C14H12 |
| 분자량 |
180.2451 |
| InChI |
InChI=1/C14H12/c1-2-12-8-10-14(11-9-12)13-6-4-3-5-7-13/h2-11H,1H2 |
| cas번호 |
2350-89-2 |
| EC번호 |
219-082-6 |
| 분자 구조 |
|
| 밀도 |
0.997g/cm3 |
| 녹는 점 |
115-121℃ |
| 비등점 |
301.7°C at 760 mmHg |
| 굴절 지수 |
1.599 |
| 인화점 |
139.4°C |
| 증기압 |
0.00185mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
