ChemNet > CAS > 2351-37-3 Biphenyldicarbonylchloride
2351-37-3 Biphenyldicarbonylchloride
상품명칭 |
Biphenyldicarbonylchloride |
영문 이름 |
Biphenyldicarbonylchloride; 4,4-Biphenyldicarbonyl chloride; 4,4'-Biphenyldicarbonyl Chloride |
분자식 |
C14H8Cl2O2 |
분자량 |
279.1181 |
InChI |
InChI=1/C14H8Cl2O2/c15-13(17)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(16)18/h1-8H |
cas번호 |
2351-37-3 |
EC번호 |
219-085-2 |
분자 구조 |
|
밀도 |
1.344g/cm3 |
녹는 점 |
184℃ |
비등점 |
407.8°C at 760 mmHg |
굴절 지수 |
1.603 |
인화점 |
224.1°C |
증기압 |
7.35E-07mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|