2362-64-3 4-Methoxythiobenzamide
상품명칭 |
4-Methoxythiobenzamide |
영문 이름 |
4-Methoxythiobenzamide;Benzenecarbothioamide, 4-methoxy-; Thio-p-anisamide; 4-methoxybenzenecarbothioamide |
분자식 |
C8H9NOS |
분자량 |
167.2282 |
InChI |
InChI=1/C8H9NOS/c1-10-7-4-2-6(3-5-7)8(9)11/h2-5H,1H3,(H2,9,11) |
cas번호 |
2362-64-3 |
분자 구조 |
|
밀도 |
1.194g/cm3 |
비등점 |
288.5°C at 760 mmHg |
굴절 지수 |
1.619 |
인화점 |
128.3°C |
증기압 |
0.00233mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/22:Harmful by inhalation and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|