ChemNet > CAS > 23806-24-8 3-Methylthiophene-2-carboxylic acid
23806-24-8 3-Methylthiophene-2-carboxylic acid
상품명칭 |
3-Methylthiophene-2-carboxylic acid |
영문 이름 |
3-Methylthiophene-2-carboxylic acid; 3-Methyl-2-thiophenecarboxylic acid; 3-methylthiophene-2-carboxylate; RARECHEM AL BO 0517; 3-Methylthiophene-2-carboxylic |
분자식 |
C6H5O2S |
분자량 |
141.1682 |
InChI |
InChI=1/C6H6O2S/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3,(H,7,8)/p-1 |
cas번호 |
23806-24-8 |
EC번호 |
245-894-5 |
분자 구조 |
|
녹는 점 |
145-146℃ |
비등점 |
274°C at 760 mmHg |
인화점 |
119.5°C |
증기압 |
0.0027mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:;
|
|