ChemNet > CAS > 23911-26-4 diethylenetriamine-pentaacetic acid dianhydride
23911-26-4 diethylenetriamine-pentaacetic acid dianhydride
상품명칭 |
diethylenetriamine-pentaacetic acid dianhydride |
영문 이름 |
diethylenetriamine-pentaacetic acid dianhydride; Diethylenetriaminepentaacetic acid dianhydride; DTPA Dianhydride; N,N-bis[2-(2,6-dioxomorpholin-4-yl)ethyl]glycine |
분자식 |
C14H19N3O8 |
분자량 |
357.316 |
InChI |
InChI=1/C14H19N3O8/c18-10(19)5-15(1-3-16-6-11(20)24-12(21)7-16)2-4-17-8-13(22)25-14(23)9-17/h1-9H2,(H,18,19) |
cas번호 |
23911-26-4 |
분자 구조 |
|
밀도 |
1.46g/cm3 |
녹는 점 |
190-184℃ |
비등점 |
656.2°C at 760 mmHg |
굴절 지수 |
1.558 |
인화점 |
350.6°C |
증기압 |
6.53E-19mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|