2396-84-1 ethyl sorbate
상품명칭 |
ethyl sorbate |
영문 이름 |
ethyl sorbate; Ethyl 2,4-hexadienoate~Sorbic acid ethyl ester; (E,E)-2,4-Hexadienoic acid ethylester; Ethyl trans,trans-2,4-hexadienoate; ethyl hexa-2,4-dienoate; ethyl (2E,4E)-hexa-2,4-dienoate; ethyl (2Z,4Z)-hexa-2,4-dienoate |
분자식 |
C8H12O2 |
분자량 |
140.1797 |
InChI |
InChI=1/C8H12O2/c1-3-5-6-7-8(9)10-4-2/h3,5-7H,4H2,1-2H3/b5-3-,7-6- |
cas번호 |
2396-84-1 |
EC번호 |
219-258-2 |
분자 구조 |
|
밀도 |
0.926g/cm3 |
비등점 |
195.5°C at 760 mmHg |
굴절 지수 |
1.454 |
인화점 |
69.4°C |
증기압 |
0.418mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|