ChemNet > CAS > 24023-71-0 2-클로로메틸-5-(4-메톡시페닐)-1,2,4-옥사디아졸
24023-71-0 2-클로로메틸-5-(4-메톡시페닐)-1,2,4-옥사디아졸
| 상품명칭 |
2-클로로메틸-5-(4-메톡시페닐)-1,2,4-옥사디아졸 |
| 별명 |
; 2-(클로로메틸)-5-(4-메톡시페닐)-1,3,4-옥사디아졸 |
| 영문 이름 |
2-Chloromethyl-5-(4-methoxyphenyl)-1,2,4-oxadiazole; 2-(Chloromethyl)-5-(4-methoxyphenyl)-1,3,4-oxadiazole |
| 분자식 |
C10H9ClN2O2 |
| 분자량 |
224.6437 |
| InChI |
InChI=1/C10H9ClN2O2/c1-14-8-4-2-7(3-5-8)10-13-12-9(6-11)15-10/h2-5H,6H2,1H3 |
| cas번호 |
24023-71-0 |
| 분자 구조 |
|
| 밀도 |
1.278g/cm3 |
| 녹는 점 |
91℃ |
| 비등점 |
354.9°C at 760 mmHg |
| 굴절 지수 |
1.547 |
| 인화점 |
168.4°C |
| 증기압 |
6.63E-05mmHg at 25°C |
| 위험성 표시 |
Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|