2432-42-0 S-Ethyl thiopropionate
상품명칭 |
S-Ethyl thiopropionate |
영문 이름 |
S-Ethyl thiopropionate; Thiopropionic acid S-ethyl ester; S-ethyl propanethioate |
분자식 |
C5H10OS |
분자량 |
118.1973 |
InChI |
InChI=1/C5H10OS/c1-3-5(6)7-4-2/h3-4H2,1-2H3 |
cas번호 |
2432-42-0 |
EC번호 |
219-405-0 |
분자 구조 |
|
밀도 |
0.967g/cm3 |
비등점 |
141.4°C at 760 mmHg |
굴절 지수 |
1.456 |
인화점 |
36°C |
증기압 |
5.87mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
|
보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|