ChemNet > CAS > 2436-96-6 2,2'-Dinitrobiphenyl
2436-96-6 2,2'-Dinitrobiphenyl
| 상품명칭 |
2,2'-Dinitrobiphenyl |
| 영문 이름 |
2,2'-Dinitrobiphenyl;2,2'-Dinitrobiphenyl, 2,2'-dinitro-; NSC 13356; 1,1'-Biphenyl, 2,2'-dinitro- (9CI); Biphenyl, 2,2'-dinitro- (8CI) |
| 분자식 |
C12H8N2O4 |
| 분자량 |
244.2029 |
| InChI |
InChI=1/C12H8N2O4/c15-13(16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)18/h1-8H |
| cas번호 |
2436-96-6 |
| EC번호 |
219-435-4 |
| 분자 구조 |
|
| 밀도 |
1.368g/cm3 |
| 녹는 점 |
123-128℃ |
| 비등점 |
387.6°C at 760 mmHg |
| 굴절 지수 |
1.635 |
| 인화점 |
187.9°C |
| 증기압 |
7.25E-06mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
