ChemNet > CAS > 24431-27-4 (4-Ethylphenoxy)-acetic acid
24431-27-4 (4-Ethylphenoxy)-acetic acid
| 상품명칭 |
(4-Ethylphenoxy)-acetic acid |
| 영문 이름 |
(4-Ethylphenoxy)-acetic acid; 4-Ethylphenoxyacetic acid |
| 분자식 |
C10H12O3 |
| 분자량 |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-2-8-3-5-9(6-4-8)13-7-10(11)12/h3-6H,2,7H2,1H3,(H,11,12) |
| cas번호 |
24431-27-4 |
| EC번호 |
246-245-9 |
| 분자 구조 |
|
| 밀도 |
1.144g/cm3 |
| 비등점 |
309.6°C at 760 mmHg |
| 굴절 지수 |
1.53 |
| 인화점 |
121.6°C |
| 증기압 |
0.000272mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
