24464-63-9 n-Decylboronic acid

상품명칭	n-Decylboronic acid
영문 이름	n-Decylboronic acid; n-Decaneboronic acid; decylboronic acid
분자식	C₁₀H₂₃BO₂
분자량	186.0994
InChI	InChI=1/C10H23BO2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h12-13H,2-10H2,1H3
cas번호	24464-63-9
분자 구조
밀도	0.883g/cm³
비등점	297.1°C at 760 mmHg
굴절 지수	1.434
인화점	133.5°C
증기압	0.000141mmHg at 25°C
위험성 표시
리스크 규칙	R36/37/38:Irritating to eyes, respiratory system and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;