ChemNet > CAS > 2455-24-5 Tetrahydrofurfuryl methacrylate
2455-24-5 Tetrahydrofurfuryl methacrylate
상품명칭 |
Tetrahydrofurfuryl methacrylate |
영문 이름 |
Tetrahydrofurfuryl methacrylate; Methacrylic acid tetrahydrofurfuryl ester; tetrahydrofuran-2-ylmethyl 2-methylprop-2-enoate |
분자식 |
C9H14O3 |
분자량 |
170.2057 |
InChI |
InChI=1/C9H14O3/c1-7(2)9(10)12-6-8-4-3-5-11-8/h8H,1,3-6H2,2H3 |
cas번호 |
2455-24-5 |
EC번호 |
219-529-5 |
분자 구조 |
|
밀도 |
1.03g/cm3 |
비등점 |
265°C at 760 mmHg |
굴절 지수 |
1.452 |
인화점 |
105.6°C |
증기압 |
0.0094mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S36:;
|
|