ChemNet > CAS > 24623-20-9 6-methyl-1-indanone
24623-20-9 6-methyl-1-indanone
| 상품명칭 |
6-methyl-1-indanone |
| 영문 이름 |
6-methyl-1-indanone; 6-methyl-2,3-dihydro-1H-inden-1-one |
| 분자식 |
C10H10O |
| 분자량 |
146.1858 |
| InChI |
InChI=1/C10H10O/c1-7-2-3-8-4-5-10(11)9(8)6-7/h2-3,6H,4-5H2,1H3 |
| cas번호 |
24623-20-9 |
| 분자 구조 |
|
| 밀도 |
1.113g/cm3 |
| 녹는 점 |
60-62℃ |
| 비등점 |
265.1°C at 760 mmHg |
| 굴절 지수 |
1.574 |
| 인화점 |
109.9°C |
| 증기압 |
0.00935mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
