ChemNet > CAS > 2471-70-7 6-methoxy-2-naphthoic acid
2471-70-7 6-methoxy-2-naphthoic acid
상품명칭 |
6-methoxy-2-naphthoic acid |
영문 이름 |
6-methoxy-2-naphthoic acid; 6-Methoxy-naphthalene-2-carboxylic acid; 6-methoxynaphthalene-2-carboxylate |
분자식 |
C12H9O3 |
분자량 |
201.1986 |
InChI |
InChI=1/C12H10O3/c1-15-11-5-4-8-6-10(12(13)14)3-2-9(8)7-11/h2-7H,1H3,(H,13,14)/p-1 |
cas번호 |
2471-70-7 |
분자 구조 |
|
비등점 |
371.1°C at 760 mmHg |
인화점 |
147.8°C |
증기압 |
3.65E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|