24800-44-0 Tripropylene glycol
상품명칭 |
Tripropylene glycol |
영문 이름 |
Tripropylene glycol; Tripropylene glycol (mixture of isomers); Tripropyleneglycol,90%; Tripropyleneglycol; TPG; 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol; 3,3'-[propane-1,2-diylbis(oxy)]dipropan-1-ol; tripropylene glycol, mixture of isomers |
분자식 |
C9H20O4 |
분자량 |
192.2527 |
InChI |
InChI=1/C9H20O4/c1-9(13-7-3-5-11)8-12-6-2-4-10/h9-11H,2-8H2,1H3 |
cas번호 |
24800-44-0 |
EC번호 |
246-466-0 |
분자 구조 |
|
밀도 |
1.038g/cm3 |
비등점 |
316.1°C at 760 mmHg |
굴절 지수 |
1.455 |
인화점 |
145°C |
증기압 |
3.54E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|