24932-48-7 4,5-Dibromo-o-xylene
상품명칭 |
4,5-Dibromo-o-xylene |
영문 이름 |
4,5-Dibromo-o-xylene; 1,2-Dibromo-4,5-dimethylbenzene |
분자식 |
C8H8Br2 |
분자량 |
263.9571 |
InChI |
InChI=1/C8H8Br2/c1-5-3-7(9)8(10)4-6(5)2/h3-4H,1-2H3 |
cas번호 |
24932-48-7 |
분자 구조 |
|
밀도 |
1.71g/cm3 |
비등점 |
279.1°C at 760 mmHg |
굴절 지수 |
1.578 |
인화점 |
138.7°C |
증기압 |
0.00694mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|