ChemNet > CAS > 25038-36-2 Ethylene/propylene/diene terpolymer
25038-36-2 Ethylene/propylene/diene terpolymer
상품명칭 |
Ethylene/propylene/diene terpolymer |
영문 이름 |
Ethylene/propylene/diene terpolymer; Poly(ethylene-co-propylene-co-5-methylene-2-norbornene); ethylene; (5E)-5-ethylidenebicyclo[2.2.1]hept-2-ene; prop-1-ene; Ethylene Propylene Diene Monomer; EPDM;
|
분자식 |
C14H22 |
분자량 |
190.3245 |
InChI |
InChI=1/C9H12.C3H6.C2H4/c1-2-8-5-7-3-4-9(8)6-7;1-3-2;1-2/h2-4,7,9H,5-6H2,1H3;3H,1H2,2H3;1-2H2/b8-2+;; |
cas번호 |
25038-36-2 |
분자 구조 |
|
비등점 |
146°C at 760 mmHg |
인화점 |
34.2°C |
증기압 |
5.98mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|