25038-71-5 폴리(에틸렌-코-테트라플루오로에틸렌)
상품명칭 |
폴리(에틸렌-코-테트라플루오로에틸렌) |
별명 |
테프젤; 에텐, 1,1,2,2-테트라플루오로-, 에텐을 가진 중합체; 에텐, 테트라플루오로-, 에텐을 가진 중합체; 에텐 - 테트라플루오로에텐 (1:1) |
영문 이름 |
poly(ethylene-co-tetrafluoroethylene);Tefzel; Ethene, 1,1,2,2-tetrafluoro-, polymer with ethene; Ethene, tetrafluoro-, polymer with ethene; ethene - tetrafluoroethene (1:1) |
분자식 |
C4H4F4 |
분자량 |
128.0682 |
InChI |
InChI=1/C2F4.C2H4/c3-1(4)2(5)6;1-2/h;1-2H2 |
cas번호 |
25038-71-5 |
분자 구조 |
|
증기압 |
20000mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|