ChemNet > CAS > 25115-74-6 4-Cyano-4-phenylcyclohexanone
25115-74-6 4-Cyano-4-phenylcyclohexanone
| 상품명칭 |
4-Cyano-4-phenylcyclohexanone |
| 영문 이름 |
4-Cyano-4-phenylcyclohexanone; 4-oxo-1-phenylcyclohexanenitrile; 4-oxo-1-phenylcyclohexanecarbonitrile |
| 분자식 |
C13H13NO |
| 분자량 |
199.2484 |
| InChI |
InChI=1/C13H13NO/c14-10-13(8-6-12(15)7-9-13)11-4-2-1-3-5-11/h1-5H,6-9H2 |
| cas번호 |
25115-74-6 |
| EC번호 |
246-631-7 |
| 분자 구조 |
|
| 밀도 |
1.12g/cm3 |
| 녹는 점 |
114-119℃ |
| 비등점 |
378.6°C at 760 mmHg |
| 굴절 지수 |
1.557 |
| 인화점 |
182.8°C |
| 증기압 |
6.22E-06mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
